CAS 2689-59-0 appears in our catalog under these names: 2-Benzoylfuran, 95%, 2-Benzoylfuran. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
Furan-2-yl(phenyl)methanone (CAS 2689-59-0) is a chemical compound with the molecular formula C11H8O2 and a molecular weight of 172.18 g/mol. IUPAC name: furan-2-yl(phenyl)methanone. InChIKey: CRLNTRZMHKNJSR-UHFFFAOYSA-N.
| Molecular formula | C11H8O2 |
|---|---|
| Molecular weight | 172.18 g/mol |
| IUPAC name | furan-2-yl(phenyl)methanone |
| InChIKey | CRLNTRZMHKNJSR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C2=CC=CO2 |
Computed by PubChem (NCBI)