CAS 269055-76-7 appears in our catalog under these names: Etravirine Impurity 5, 6-Desamino 6-Chloro Etravirine, >95% (HPLC). Offered by: Hubei YoungXin, TRC. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
4-[5-bromo-6-chloro-2-(4-cyanoanilino)pyrimidin-4-yl]oxy-3,5-dimethylbenzonitrile (CAS 269055-76-7) is a chemical compound with the molecular formula C20H13BrClN5O and a molecular weight of 454.7 g/mol. IUPAC name: 4-[5-bromo-6-chloro-2-(4-cyanoanilino)pyrimidin-4-yl]oxy-3,5-dimethylbenzonitrile. InChIKey: ODWHQRYHASBLKO-UHFFFAOYSA-N.
| Molecular formula | C20H13BrClN5O |
|---|---|
| Molecular weight | 454.7 g/mol |
| IUPAC name | 4-[5-bromo-6-chloro-2-(4-cyanoanilino)pyrimidin-4-yl]oxy-3,5-dimethylbenzonitrile |
| InChIKey | ODWHQRYHASBLKO-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1OC2=C(C(=NC(=N2)NC3=CC=C(C=C3)C#N)Cl)Br)C)C#N |
Computed by PubChem (NCBI)