CAS 269055-78-9 is the registry number for Etravirine Impurity 15. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
4-[5-amino-6-chloro-2-(4-cyanoanilino)pyrimidin-4-yl]oxy-3,5-dimethylbenzonitrile (CAS 269055-78-9) is a chemical compound with the molecular formula C20H15ClN6O and a molecular weight of 390.8 g/mol. IUPAC name: 4-[5-amino-6-chloro-2-(4-cyanoanilino)pyrimidin-4-yl]oxy-3,5-dimethylbenzonitrile. InChIKey: LFWTXTHNAPWTLX-UHFFFAOYSA-N.
| Molecular formula | C20H15ClN6O |
|---|---|
| Molecular weight | 390.8 g/mol |
| IUPAC name | 4-[5-amino-6-chloro-2-(4-cyanoanilino)pyrimidin-4-yl]oxy-3,5-dimethylbenzonitrile |
| InChIKey | LFWTXTHNAPWTLX-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1OC2=C(C(=NC(=N2)NC3=CC=C(C=C3)C#N)Cl)N)C)C#N |
Computed by PubChem (NCBI)