CAS 269058-50-6 is the registry number for 3-Bromo-6-methoxy-2-methyl-pyridine 1-oxide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 10g.
3-bromo-6-methoxy-2-methyl-1-oxidopyridin-1-ium (CAS 269058-50-6) is a chemical compound with the molecular formula C7H8BrNO2 and a molecular weight of 218.05 g/mol. IUPAC name: 3-bromo-6-methoxy-2-methyl-1-oxidopyridin-1-ium. InChIKey: GKHNPEMIHCUEHI-UHFFFAOYSA-N.
| Molecular formula | C7H8BrNO2 |
|---|---|
| Molecular weight | 218.05 g/mol |
| IUPAC name | 3-bromo-6-methoxy-2-methyl-1-oxidopyridin-1-ium |
| InChIKey | GKHNPEMIHCUEHI-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=[N+]1[O-])OC)Br |
Computed by PubChem (NCBI)