CAS 269061-41-8 appears in our catalog under these names: Fmoc-nepsilon-2,4-dinitrophenyl-d-lysine, 95%, Fmoc-D-Lys(Dnp)-OH, Fmoc–D–Lys(Dnp)–OH, Fmoc-D-Lys(Dnp)-OH, ≥95%, ≥95%. Offered by: Combi-blocks, Creative Peptides, GLPBio, Iris Biotech, Chemat. Available pack sizes: 100mg, 1g, 250mg, 5g, 25g, 500mg.
(2R)-6-(3,5-dinitroanilino)-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoic acid (CAS 269061-41-8) is a chemical compound with the molecular formula C27H26N4O8 and a molecular weight of 534.5 g/mol. IUPAC name: (2R)-6-(3,5-dinitroanilino)-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoic acid. InChIKey: SSGITEQCSCXMRC-RUZDIDTESA-N.
| Molecular formula | C27H26N4O8 |
|---|---|
| Molecular weight | 534.5 g/mol |
| IUPAC name | (2R)-6-(3,5-dinitroanilino)-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoic acid |
| InChIKey | SSGITEQCSCXMRC-RUZDIDTESA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@H](CCCCNC4=CC(=CC(=C4)[N+](=O)[O-])[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)