CAS 2692623-94-0 is the registry number for Propionyl-L-carnitine-d3 (hydrochloride), 99.9%. Offered by: MedChemExpress. Available pack sizes: 1 mg, 5 mg, 10 mg.
[(2S)-3-carboxy-2-propanoyloxypropyl]-trimethylazanium (CAS 2692623-94-0) is a chemical compound with the molecular formula C10H20NO4+ and a molecular weight of 218.27 g/mol. IUPAC name: [(2S)-3-carboxy-2-propanoyloxypropyl]-trimethylazanium. InChIKey: UFAHZIUFPNSHSL-QMMMGPOBSA-O.
| Molecular formula | C10H20NO4+ |
|---|---|
| Molecular weight | 218.27 g/mol |
| IUPAC name | [(2S)-3-carboxy-2-propanoyloxypropyl]-trimethylazanium |
| InChIKey | UFAHZIUFPNSHSL-QMMMGPOBSA-O |
| SMILES | CCC(=O)O[C@@H](CC(=O)O)C[N+](C)(C)C |
Computed by PubChem (NCBI)