CAS 2692624-22-7 appears in our catalog under these names: C6 Ceramide–d7 (d18:1–d7/6:0), Ceramide C6-d7, 99.0%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 500μg, 500 μg (2.47 mM * 500 μL in Methanol).
N-[(E,2S,3R)-16,16,17,17,18,18,18-heptadeuterio-1,3-dihydroxyoctadec-4-en-2-yl]hexanamide (CAS 2692624-22-7) is a chemical compound with the molecular formula C24H47NO3 and a molecular weight of 404.7 g/mol. IUPAC name: N-[(E,2S,3R)-16,16,17,17,18,18,18-heptadeuterio-1,3-dihydroxyoctadec-4-en-2-yl]hexanamide. InChIKey: NPRJSFWNFTXXQC-OMMXNDSESA-N.
| Molecular formula | C24H47NO3 |
|---|---|
| Molecular weight | 404.7 g/mol |
| IUPAC name | N-[(E,2S,3R)-16,16,17,17,18,18,18-heptadeuterio-1,3-dihydroxyoctadec-4-en-2-yl]hexanamide |
| InChIKey | NPRJSFWNFTXXQC-OMMXNDSESA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])CCCCCCCCCC/C=C/[C@H]([C@H](CO)NC(=O)CCCCC)O |
Computed by PubChem (NCBI)