Products 2693397-44-1
CAS 2693397-44-1 is the registry number for MMB–FUBICA metabolite 3. Offered by: GLPBio. Available pack sizes: 1mg, 5mg.
(2S)-2-[[1-[(4-fluorophenyl)methyl]indole-3-carbonyl]amino]-3-methylbutanoic acid (CAS 2693397-44-1) is a chemical compound with the molecular formula C21H21FN2O3 and a molecular weight of 368.4 g/mol. IUPAC name: (2S)-2-[[1-[(4-fluorophenyl)methyl]indole-3-carbonyl]amino]-3-methylbutanoic acid. InChIKey: GLSZASCWFBSHNV-IBGZPJMESA-N.
| Molecular formula | C21H21FN2O3 |
|---|---|
| Molecular weight | 368.4 g/mol |
| IUPAC name | (2S)-2-[[1-[(4-fluorophenyl)methyl]indole-3-carbonyl]amino]-3-methylbutanoic acid |
| InChIKey | GLSZASCWFBSHNV-IBGZPJMESA-N |
| SMILES | CC(C)[C@@H](C(=O)O)NC(=O)C1=CN(C2=CC=CC=C21)CC3=CC=C(C=C3)F |
Computed by PubChem (NCBI)