CAS 269396-56-7 appears in our catalog under these names: (R)–3–(Boc–amino)–4–(3,4–dichlorophenyl)butyric acid, Boc-(R)-3-Amino-4-(3,4-dichloro-phenyl)-butyric acid, 98%, 98%, (R)-3-((tert-Butoxycarbonyl)amino)-4-(3,4-dichlorophenyl)butanoic acid, 98%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 50mg, 5g, 100mg.
(3R)-4-(3,4-dichlorophenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid (CAS 269396-56-7) is a chemical compound with the molecular formula C15H19Cl2NO4 and a molecular weight of 348.2 g/mol. IUPAC name: (3R)-4-(3,4-dichlorophenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid. InChIKey: WJEUUKADFJNOHW-SNVBAGLBSA-N.
| Molecular formula | C15H19Cl2NO4 |
|---|---|
| Molecular weight | 348.2 g/mol |
| IUPAC name | (3R)-4-(3,4-dichlorophenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
| InChIKey | WJEUUKADFJNOHW-SNVBAGLBSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CC1=CC(=C(C=C1)Cl)Cl)CC(=O)O |
Computed by PubChem (NCBI)