CAS 269398-95-0 is the registry number for (R)-3-Amino-4-(3-benzothienyl)butanoic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.
(3R)-3-amino-4-(1-benzothiophen-3-yl)butanoic acid;hydrochloride (CAS 269398-95-0) is a chemical compound with the molecular formula C12H14ClNO2S and a molecular weight of 271.76 g/mol. IUPAC name: (3R)-3-amino-4-(1-benzothiophen-3-yl)butanoic acid;hydrochloride. InChIKey: WBZKGWWYBOKXAS-SBSPUUFOSA-N.
| Molecular formula | C12H14ClNO2S |
|---|---|
| Molecular weight | 271.76 g/mol |
| IUPAC name | (3R)-3-amino-4-(1-benzothiophen-3-yl)butanoic acid;hydrochloride |
| InChIKey | WBZKGWWYBOKXAS-SBSPUUFOSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CS2)C[C@H](CC(=O)O)N.Cl |
Computed by PubChem (NCBI)