CAS 26940-56-7 appears in our catalog under these names: 2-(3-Carboxyanilino)-4,6-dichloro-1,3,5-triazine, 95%, 3-((4,6-Dichloro-1,3,5-triazin-2-yl)amino)benzoic acid, 95+%, 2–(3–Carboxyanilino)–4,6–dichloro–1,3,5–triazine. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 25g, 1g, 5g.
3-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]benzoic acid (CAS 26940-56-7) is a chemical compound with the molecular formula C10H6Cl2N4O2 and a molecular weight of 285.08 g/mol. IUPAC name: 3-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]benzoic acid. InChIKey: WQKKRBIBVKBSPV-UHFFFAOYSA-N.
| Molecular formula | C10H6Cl2N4O2 |
|---|---|
| Molecular weight | 285.08 g/mol |
| IUPAC name | 3-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]benzoic acid |
| InChIKey | WQKKRBIBVKBSPV-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)NC2=NC(=NC(=N2)Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)