Products 26943-74-8

CAS 26943-74-8 is the registry number for 3-Methylbutan-2-yl methanesulfonate. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.

Structural formula: {0} (CAS {1})

3-methylbutan-2-yl methanesulfonate (CAS 26943-74-8) is a chemical compound with the molecular formula C6H14O3S and a molecular weight of 166.24 g/mol. IUPAC name: 3-methylbutan-2-yl methanesulfonate. InChIKey: HREPGPGLHZOQGE-UHFFFAOYSA-N.

Identity
Molecular formulaC6H14O3S
Molecular weight166.24 g/mol
IUPAC name3-methylbutan-2-yl methanesulfonate
InChIKeyHREPGPGLHZOQGE-UHFFFAOYSA-N
SMILESCC(C)C(C)OS(=O)(=O)C

Computed by PubChem (NCBI)