Products 2694805-94-0
CAS 2694805-94-0 is the registry number for Antibacterial agent 232. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2,3,5-trichlorophenyl)methyl 3,3,3-trifluoropropanoate (CAS 2694805-94-0) is a chemical compound with the molecular formula C10H6Cl3F3O2 and a molecular weight of 321.5 g/mol. IUPAC name: (2,3,5-trichlorophenyl)methyl 3,3,3-trifluoropropanoate. InChIKey: TVJSDVZFNHBYRP-UHFFFAOYSA-N.
| Molecular formula | C10H6Cl3F3O2 |
|---|---|
| Molecular weight | 321.5 g/mol |
| IUPAC name | (2,3,5-trichlorophenyl)methyl 3,3,3-trifluoropropanoate |
| InChIKey | TVJSDVZFNHBYRP-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1COC(=O)CC(F)(F)F)Cl)Cl)Cl |
Computed by PubChem (NCBI)
Synonyms:
Antibacterial agent 232, orb2646249