CAS 2696457-91-5 is the registry number for Ethyl 7,8-difluoro-4-hydroxy-2-naphthoate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 7,8-difluoro-4-hydroxynaphthalene-2-carboxylate (CAS 2696457-91-5) is a chemical compound with the molecular formula C13H10F2O3 and a molecular weight of 252.21 g/mol. IUPAC name: ethyl 7,8-difluoro-4-hydroxynaphthalene-2-carboxylate. InChIKey: PJLHZZODTGPFTO-UHFFFAOYSA-N.
| Molecular formula | C13H10F2O3 |
|---|---|
| Molecular weight | 252.21 g/mol |
| IUPAC name | ethyl 7,8-difluoro-4-hydroxynaphthalene-2-carboxylate |
| InChIKey | PJLHZZODTGPFTO-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC2=C(C=CC(=C2F)F)C(=C1)O |
Computed by PubChem (NCBI)