Products 269741-29-9
CAS 269741-29-9 is the registry number for tert-butyl 4-(3-fluorobenzoyl)piperidine-1-carboxylate, 95%. Offered by: Chemat. Available pack sizes: 50mg, 100mg.
Tert-butyl 4-(3-fluorobenzoyl)piperidine-1-carboxylate (CAS 269741-29-9) is a chemical compound with the molecular formula C17H22FNO3 and a molecular weight of 307.36 g/mol. IUPAC name: tert-butyl 4-(3-fluorobenzoyl)piperidine-1-carboxylate. InChIKey: PNCDXUYGMZPOLQ-UHFFFAOYSA-N.
| Molecular formula | C17H22FNO3 |
|---|---|
| Molecular weight | 307.36 g/mol |
| IUPAC name | tert-butyl 4-(3-fluorobenzoyl)piperidine-1-carboxylate |
| InChIKey | PNCDXUYGMZPOLQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC1)C(=O)C2=CC(=CC=C2)F |
Computed by PubChem (NCBI)