CAS 26988-61-4 appears in our catalog under these names: (R)-2-(2-Amino-3-(tritylthio)propanamido)acetic acid, 90%, (R)–2–(2–Amino–3–(tritylthio)propanamido)acetic acid, (R)-2-(2-Amino-3-(tritylthio)propanamido)acetic acid, ≥90%, ≥90%, N-[S-Trityl-L-cysteinyl]glycine, (R)-2-(2-Amino-3-(tritylthio)propanamido)acetic acid, 95%. Offered by: AmBeed, GLPBio, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 1g, 10g, 5g, 25g, 100 mg, 1 g, 500 mg.
2-[(2-amino-3-tritylsulfanylpropanoyl)amino]acetic acid (CAS 26988-61-4) is a chemical compound with the molecular formula C24H24N2O3S and a molecular weight of 420.5 g/mol. IUPAC name: 2-[(2-amino-3-tritylsulfanylpropanoyl)amino]acetic acid. InChIKey: CQWAYRTZXZSUEP-UHFFFAOYSA-N.
| Molecular formula | C24H24N2O3S |
|---|---|
| Molecular weight | 420.5 g/mol |
| IUPAC name | 2-[(2-amino-3-tritylsulfanylpropanoyl)amino]acetic acid |
| InChIKey | CQWAYRTZXZSUEP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=CC=C3)SCC(C(=O)NCC(=O)O)N |
Computed by PubChem (NCBI)