CAS 2699028-49-2 is the registry number for 2,5-BMeS-p-A-NHS, >97.0%(HPLC). Offered by: TCI. Available pack sizes: 5mg, 25mg.
(2,5-dioxopyrrolidin-1-yl) 3-[4-amino-2,5-bis(methylsulfonyl)anilino]propanoate (CAS 2699028-49-2) is a chemical compound with the molecular formula C15H19N3O8S2 and a molecular weight of 433.5 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 3-[4-amino-2,5-bis(methylsulfonyl)anilino]propanoate. InChIKey: XYQXSDYEQQGHHT-UHFFFAOYSA-N.
| Molecular formula | C15H19N3O8S2 |
|---|---|
| Molecular weight | 433.5 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 3-[4-amino-2,5-bis(methylsulfonyl)anilino]propanoate |
| InChIKey | XYQXSDYEQQGHHT-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC(=C(C=C1N)S(=O)(=O)C)NCCC(=O)ON2C(=O)CCC2=O |
Computed by PubChem (NCBI)