Products 2700187-91-1
CAS 2700187-91-1 is the registry number for BG dimer. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-N-(4-amino-6-phenyl-1,3,5-triazin-2-yl)-6-phenyl-1,3,5-triazine-2,4-diamine (CAS 2700187-91-1) is a chemical compound with the molecular formula C18H15N9 and a molecular weight of 357.4 g/mol. IUPAC name: 2-N-(4-amino-6-phenyl-1,3,5-triazin-2-yl)-6-phenyl-1,3,5-triazine-2,4-diamine. InChIKey: RUSRQFRWEGAZDY-UHFFFAOYSA-N.
| Molecular formula | C18H15N9 |
|---|---|
| Molecular weight | 357.4 g/mol |
| IUPAC name | 2-N-(4-amino-6-phenyl-1,3,5-triazin-2-yl)-6-phenyl-1,3,5-triazine-2,4-diamine |
| InChIKey | RUSRQFRWEGAZDY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC(=NC(=N2)NC3=NC(=NC(=N3)N)C4=CC=CC=C4)N |
Computed by PubChem (NCBI)
Synonyms:
BG dimer, orb1690668