CAS 27004-40-6 is the registry number for Coppertartrate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Copper 2,3-dihydroxybutanedioate (CAS 27004-40-6) is a chemical compound with the molecular formula C4H4CuO6 and a molecular weight of 211.62 g/mol. IUPAC name: copper 2,3-dihydroxybutanedioate. InChIKey: RSJOBNMOMQFPKQ-UHFFFAOYSA-L.
| Molecular formula | C4H4CuO6 |
|---|---|
| Molecular weight | 211.62 g/mol |
| IUPAC name | copper 2,3-dihydroxybutanedioate |
| InChIKey | RSJOBNMOMQFPKQ-UHFFFAOYSA-L |
| SMILES | C(C(C(=O)[O-])O)(C(=O)[O-])O.[Cu+2] |
Computed by PubChem (NCBI)