CAS 270063-41-7 is the registry number for (S)-3-Amino-4-pentafluorophenylbutanoic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.
(3S)-3-amino-4-(2,3,4,5,6-pentafluorophenyl)butanoic acid;hydrochloride (CAS 270063-41-7) is a chemical compound with the molecular formula C10H9ClF5NO2 and a molecular weight of 305.63 g/mol. IUPAC name: (3S)-3-amino-4-(2,3,4,5,6-pentafluorophenyl)butanoic acid;hydrochloride. InChIKey: ZZFVLTJRIMBREK-DFWYDOINSA-N.
| Molecular formula | C10H9ClF5NO2 |
|---|---|
| Molecular weight | 305.63 g/mol |
| IUPAC name | (3S)-3-amino-4-(2,3,4,5,6-pentafluorophenyl)butanoic acid;hydrochloride |
| InChIKey | ZZFVLTJRIMBREK-DFWYDOINSA-N |
| SMILES | C(C1=C(C(=C(C(=C1F)F)F)F)F)[C@@H](CC(=O)O)N.Cl |
Computed by PubChem (NCBI)