Products 270063-41-7

CAS 270063-41-7 is the registry number for (S)-3-Amino-4-pentafluorophenylbutanoic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

(3S)-3-amino-4-(2,3,4,5,6-pentafluorophenyl)butanoic acid;hydrochloride (CAS 270063-41-7) is a chemical compound with the molecular formula C10H9ClF5NO2 and a molecular weight of 305.63 g/mol. IUPAC name: (3S)-3-amino-4-(2,3,4,5,6-pentafluorophenyl)butanoic acid;hydrochloride. InChIKey: ZZFVLTJRIMBREK-DFWYDOINSA-N.

Identity
Molecular formulaC10H9ClF5NO2
Molecular weight305.63 g/mol
IUPAC name(3S)-3-amino-4-(2,3,4,5,6-pentafluorophenyl)butanoic acid;hydrochloride
InChIKeyZZFVLTJRIMBREK-DFWYDOINSA-N
SMILESC(C1=C(C(=C(C(=C1F)F)F)F)F)[C@@H](CC(=O)O)N.Cl

Computed by PubChem (NCBI)