Products 270063-43-9
CAS 270063-43-9 is the registry number for Fmoc-(S)-3-Amino-4-(pentafluoro-phenyl)-butyric acid, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-(2,3,4,5,6-pentafluorophenyl)butanoic acid (CAS 270063-43-9) is a chemical compound with the molecular formula C25H18F5NO4 and a molecular weight of 491.4 g/mol. IUPAC name: (3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-(2,3,4,5,6-pentafluorophenyl)butanoic acid. InChIKey: HCBMYXPXBOUBBR-LBPRGKRZSA-N.
| Molecular formula | C25H18F5NO4 |
|---|---|
| Molecular weight | 491.4 g/mol |
| IUPAC name | (3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-(2,3,4,5,6-pentafluorophenyl)butanoic acid |
| InChIKey | HCBMYXPXBOUBBR-LBPRGKRZSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CC4=C(C(=C(C(=C4F)F)F)F)F)CC(=O)O |
Computed by PubChem (NCBI)