Products 270079-48-6

CAS 270079-48-6 is the registry number for N-Methylhistaprodifen Dioxalate Salt. Offered by: TRC. Available pack sizes: 100mg.

Structural formula: {0} (CAS {1})

2-[2-(3,3-diphenylpropyl)-1H-imidazol-5-yl]-N-methylethanamine;oxalic acid (CAS 270079-48-6) is a chemical compound with the molecular formula C25H29N3O8 and a molecular weight of 499.5 g/mol. IUPAC name: 2-[2-(3,3-diphenylpropyl)-1H-imidazol-5-yl]-N-methylethanamine;oxalic acid. InChIKey: ZKOVWJDRJCVMKH-UHFFFAOYSA-N.

Identity
Molecular formulaC25H29N3O8
Molecular weight499.5 g/mol
IUPAC name2-[2-(3,3-diphenylpropyl)-1H-imidazol-5-yl]-N-methylethanamine;oxalic acid
InChIKeyZKOVWJDRJCVMKH-UHFFFAOYSA-N
SMILESCNCCC1=CN=C(N1)CCC(C2=CC=CC=C2)C3=CC=CC=C3.C(=O)(C(=O)O)O.C(=O)(C(=O)O)O

Computed by PubChem (NCBI)