CAS 270079-48-6 is the registry number for N-Methylhistaprodifen Dioxalate Salt. Offered by: TRC. Available pack sizes: 100mg.
2-[2-(3,3-diphenylpropyl)-1H-imidazol-5-yl]-N-methylethanamine;oxalic acid (CAS 270079-48-6) is a chemical compound with the molecular formula C25H29N3O8 and a molecular weight of 499.5 g/mol. IUPAC name: 2-[2-(3,3-diphenylpropyl)-1H-imidazol-5-yl]-N-methylethanamine;oxalic acid. InChIKey: ZKOVWJDRJCVMKH-UHFFFAOYSA-N.
| Molecular formula | C25H29N3O8 |
|---|---|
| Molecular weight | 499.5 g/mol |
| IUPAC name | 2-[2-(3,3-diphenylpropyl)-1H-imidazol-5-yl]-N-methylethanamine;oxalic acid |
| InChIKey | ZKOVWJDRJCVMKH-UHFFFAOYSA-N |
| SMILES | CNCCC1=CN=C(N1)CCC(C2=CC=CC=C2)C3=CC=CC=C3.C(=O)(C(=O)O)O.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)