Products 2701570-79-6
CAS 2701570-79-6 is the registry number for Asperglaucin A. Offered by: MedChemExpress. Available pack sizes: Get quote.
(3S)-4,7-dihydroxy-3-[(1R)-1-hydroxyhexyl]-6-(3-methylbut-2-enyl)-3H-2-benzothiophen-1-one (CAS 2701570-79-6) is a chemical compound with the molecular formula C19H26O4S and a molecular weight of 350.5 g/mol. IUPAC name: (3S)-4,7-dihydroxy-3-[(1R)-1-hydroxyhexyl]-6-(3-methylbut-2-enyl)-3H-2-benzothiophen-1-one. InChIKey: ZUNAGDCYBXZQBT-FZKQIMNGSA-N.
| Molecular formula | C19H26O4S |
|---|---|
| Molecular weight | 350.5 g/mol |
| IUPAC name | (3S)-4,7-dihydroxy-3-[(1R)-1-hydroxyhexyl]-6-(3-methylbut-2-enyl)-3H-2-benzothiophen-1-one |
| InChIKey | ZUNAGDCYBXZQBT-FZKQIMNGSA-N |
| SMILES | CCCCC[C@H]([C@@H]1C2=C(C=C(C(=C2C(=O)S1)O)CC=C(C)C)O)O |
Computed by PubChem (NCBI)
Synonyms:
Asperglaucin A, orb1981969