CAS 2702-72-9 appears in our catalog under these names: 2,4-D-Sodium salt monohydrate, 2,4–Dichlorophenoxyacetic acid, 2,4-D (sodium), 98.0%, 2,4-D (sodium) (Standard). Offered by: Chemat Brand, GLPBio, MedChemExpress. Available pack sizes: on request, 100g, 500g, 10 g, 1 g, 500 mg, 10mM/1mL, 5 g.
CAS 2702-72-9 identifies a chemical compound with the molecular formula C8H6Cl2NaO3 and a molecular weight of 244.02 g/mol. InChIKey: UFJKHDMPEUOKGV-UHFFFAOYSA-N.
| Molecular formula | C8H6Cl2NaO3 |
|---|---|
| Molecular weight | 244.02 g/mol |
| InChIKey | UFJKHDMPEUOKGV-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Cl)OCC(=O)O.[Na] |
Computed by PubChem (NCBI)