CAS 2702323-20-2 appears in our catalog under these names: 8-Bromo-3-chloroisoquinolin-1(2H)-one, 98%, 8-Bromo-3-chloroisoquinolin-1(2H)-one, ≥95%, ≥95%. Offered by: AmBeed, Chemat. Available pack sizes: 1g, 100mg, 250mg.
8-bromo-3-chloro-2H-isoquinolin-1-one (CAS 2702323-20-2) is a chemical compound with the molecular formula C9H5BrClNO and a molecular weight of 258.50 g/mol. IUPAC name: 8-bromo-3-chloro-2H-isoquinolin-1-one. InChIKey: LJULTOGHZNYIAC-UHFFFAOYSA-N.
| Molecular formula | C9H5BrClNO |
|---|---|
| Molecular weight | 258.50 g/mol |
| IUPAC name | 8-bromo-3-chloro-2H-isoquinolin-1-one |
| InChIKey | LJULTOGHZNYIAC-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Br)C(=O)NC(=C2)Cl |
Computed by PubChem (NCBI)