Products 2702457-83-6

CAS 2702457-83-6 is the registry number for 7-Bromoimidazo[1,2-b]pyridazine, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

7-bromoimidazo[1,2-b]pyridazine (CAS 2702457-83-6) is a chemical compound with the molecular formula C6H4BrN3 and a molecular weight of 198.02 g/mol. IUPAC name: 7-bromoimidazo[1,2-b]pyridazine. InChIKey: IGKJVJDJMQCZGI-UHFFFAOYSA-N.

Identity
Molecular formulaC6H4BrN3
Molecular weight198.02 g/mol
IUPAC name7-bromoimidazo[1,2-b]pyridazine
InChIKeyIGKJVJDJMQCZGI-UHFFFAOYSA-N
SMILESC1=CN2C(=N1)C=C(C=N2)Br

Computed by PubChem (NCBI)