CAS 2702673-78-5 appears in our catalog under these names: PTP1B–IN–3 diammonium, PTP1B-IN-3 (diammonium), 95%, 95%, PTP1B-IN-3 (diammonium), 95.38%. Offered by: GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 1 mg.
Azane;[(3-bromo-7-cyanonaphthalen-2-yl)-difluoromethyl]phosphonic acid (CAS 2702673-78-5) is a chemical compound with the molecular formula C12H13BrF2N3O3P and a molecular weight of 396.12 g/mol. IUPAC name: azane;[(3-bromo-7-cyanonaphthalen-2-yl)-difluoromethyl]phosphonic acid. InChIKey: DKKOXAMRGUYZIQ-UHFFFAOYSA-N.
| Molecular formula | C12H13BrF2N3O3P |
|---|---|
| Molecular weight | 396.12 g/mol |
| IUPAC name | azane;[(3-bromo-7-cyanonaphthalen-2-yl)-difluoromethyl]phosphonic acid |
| InChIKey | DKKOXAMRGUYZIQ-UHFFFAOYSA-N |
| SMILES | C1=CC2=CC(=C(C=C2C=C1C#N)C(F)(F)P(=O)(O)O)Br.N.N |
Computed by PubChem (NCBI)