CAS 2703484-89-1 is the registry number for (S)-Ruxolitinib Phosphate, 95%, 95%. Offered by: Chemat. Available pack sizes: 10mg.
(3S)-3-cyclopentyl-3-[4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)pyrazol-1-yl]propanenitrile;phosphoric acid (CAS 2703484-89-1) is a chemical compound with the molecular formula C17H21N6O4P and a molecular weight of 404.4 g/mol. IUPAC name: (3S)-3-cyclopentyl-3-[4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)pyrazol-1-yl]propanenitrile;phosphoric acid. InChIKey: JFMWPOCYMYGEDM-RSAXXLAASA-N.
| Molecular formula | C17H21N6O4P |
|---|---|
| Molecular weight | 404.4 g/mol |
| IUPAC name | (3S)-3-cyclopentyl-3-[4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)pyrazol-1-yl]propanenitrile;phosphoric acid |
| InChIKey | JFMWPOCYMYGEDM-RSAXXLAASA-N |
| SMILES | C1CCC(C1)[C@H](CC#N)N2C=C(C=N2)C3=C4C=CNC4=NC=N3.OP(=O)(O)O |
Computed by PubChem (NCBI)