CAS 2703778-87-2 is the registry number for (5-(2,4-Difluorophenyl)-3-azabicyclo[3.1.1]heptan-1-yl)methanol, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
[5-(2,4-difluorophenyl)-3-azabicyclo[3.1.1]heptan-1-yl]methanol (CAS 2703778-87-2) is a chemical compound with the molecular formula C13H15F2NO and a molecular weight of 239.26 g/mol. IUPAC name: [5-(2,4-difluorophenyl)-3-azabicyclo[3.1.1]heptan-1-yl]methanol. InChIKey: FSLMSAZLZYTCQB-UHFFFAOYSA-N.
| Molecular formula | C13H15F2NO |
|---|---|
| Molecular weight | 239.26 g/mol |
| IUPAC name | [5-(2,4-difluorophenyl)-3-azabicyclo[3.1.1]heptan-1-yl]methanol |
| InChIKey | FSLMSAZLZYTCQB-UHFFFAOYSA-N |
| SMILES | C1C2(CC1(CNC2)C3=C(C=C(C=C3)F)F)CO |
Computed by PubChem (NCBI)