Products 2704135-58-8
CAS 2704135-58-8 appears in our catalog under these names: 3,4–DHMA (trifluoroacetate salt), 3,4-DHMA (TFA), 99.9%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 10mg, 5mg, 50mg, 10 mg (33.87 mM * 1 mL in Methanol), 5 mg (33.87 mM * 500 μL in Methanol).
4-[2-(methylamino)propyl]benzene-1,2-diol;2,2,2-trifluoroacetic acid (CAS 2704135-58-8) is a chemical compound with the molecular formula C12H16F3NO4 and a molecular weight of 295.25 g/mol. IUPAC name: 4-[2-(methylamino)propyl]benzene-1,2-diol;2,2,2-trifluoroacetic acid. InChIKey: LJVGZBZRHGIKRY-UHFFFAOYSA-N.
| Molecular formula | C12H16F3NO4 |
|---|---|
| Molecular weight | 295.25 g/mol |
| IUPAC name | 4-[2-(methylamino)propyl]benzene-1,2-diol;2,2,2-trifluoroacetic acid |
| InChIKey | LJVGZBZRHGIKRY-UHFFFAOYSA-N |
| SMILES | CC(CC1=CC(=C(C=C1)O)O)NC.C(=O)(C(F)(F)F)O |
Computed by PubChem (NCBI)