Products 2704278-85-1
CAS 2704278-85-1 appears in our catalog under these names: 9–PAHSA–d4, 9-PAHSA-d4. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 100μg, 250μg, 500μg, 100 μg.
9-(7,7,8,8-tetradeuteriohexadecanoyloxy)octadecanoic acid (CAS 2704278-85-1) is a chemical compound with the molecular formula C34H66O4 and a molecular weight of 542.9 g/mol. IUPAC name: 9-(7,7,8,8-tetradeuteriohexadecanoyloxy)octadecanoic acid. InChIKey: MHQWHZLXDBVXML-QZPARXMSSA-N.
| Molecular formula | C34H66O4 |
|---|---|
| Molecular weight | 542.9 g/mol |
| IUPAC name | 9-(7,7,8,8-tetradeuteriohexadecanoyloxy)octadecanoic acid |
| InChIKey | MHQWHZLXDBVXML-QZPARXMSSA-N |
| SMILES | [2H]C([2H])(CCCCCCCC)C([2H])([2H])CCCCCC(=O)OC(CCCCCCCCC)CCCCCCCC(=O)O |
Computed by PubChem (NCBI)