Products 2704345-00-4
CAS 2704345-00-4 appears in our catalog under these names: (R)-2-Thioxothiazolidine-4-carboxylic acid-13C3, (R)-2-Thioxothiazolidine-4-carboxylic Acid-13C3, >95% (HPLC). Offered by: MedChemExpress, TRC. Available pack sizes: 500 μg, 0,5mg, 10mg, 1mg.
(4R)-2-sulfanylidene-(4,5-13C2)1,3-thiazolidine-4-carboxylic acid (CAS 2704345-00-4) is a chemical compound with the molecular formula C4H5NO2S2 and a molecular weight of 166.20 g/mol. IUPAC name: (4R)-2-sulfanylidene-(4,5-13C2)1,3-thiazolidine-4-carboxylic acid. InChIKey: SQUOCHQOQMZGQP-GCCOVPGMSA-N.
| Molecular formula | C4H5NO2S2 |
|---|---|
| Molecular weight | 166.20 g/mol |
| IUPAC name | (4R)-2-sulfanylidene-(4,5-13C2)1,3-thiazolidine-4-carboxylic acid |
| InChIKey | SQUOCHQOQMZGQP-GCCOVPGMSA-N |
| SMILES | [13CH2]1[13C@H](NC(=S)S1)[13C](=O)O |
Computed by PubChem (NCBI)