CAS 2705189-79-1 is the registry number for 4-(4,5-Diphenyl-1H-imidazol-2-yl)benzoyl Chloride Hydrochloride [for HPLC Labeling], >97.0%(T). Offered by: TCI. Available pack sizes: 100mg.
4-(4,5-diphenyl-1H-imidazol-2-yl)benzoyl chloride;hydrochloride (CAS 2705189-79-1) is a chemical compound with the molecular formula C22H16Cl2N2O and a molecular weight of 395.3 g/mol. IUPAC name: 4-(4,5-diphenyl-1H-imidazol-2-yl)benzoyl chloride;hydrochloride. InChIKey: DLCZLPBEOVPLJE-UHFFFAOYSA-N.
| Molecular formula | C22H16Cl2N2O |
|---|---|
| Molecular weight | 395.3 g/mol |
| IUPAC name | 4-(4,5-diphenyl-1H-imidazol-2-yl)benzoyl chloride;hydrochloride |
| InChIKey | DLCZLPBEOVPLJE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(N=C(N2)C3=CC=C(C=C3)C(=O)Cl)C4=CC=CC=C4.Cl |
Computed by PubChem (NCBI)