Products 2705189-79-1

CAS 2705189-79-1 is the registry number for 4-(4,5-Diphenyl-1H-imidazol-2-yl)benzoyl Chloride Hydrochloride [for HPLC Labeling], >97.0%(T). Offered by: TCI. Available pack sizes: 100mg.

Structural formula: {0} (CAS {1})

4-(4,5-diphenyl-1H-imidazol-2-yl)benzoyl chloride;hydrochloride (CAS 2705189-79-1) is a chemical compound with the molecular formula C22H16Cl2N2O and a molecular weight of 395.3 g/mol. IUPAC name: 4-(4,5-diphenyl-1H-imidazol-2-yl)benzoyl chloride;hydrochloride. InChIKey: DLCZLPBEOVPLJE-UHFFFAOYSA-N.

Identity
Molecular formulaC22H16Cl2N2O
Molecular weight395.3 g/mol
IUPAC name4-(4,5-diphenyl-1H-imidazol-2-yl)benzoyl chloride;hydrochloride
InChIKeyDLCZLPBEOVPLJE-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)C2=C(N=C(N2)C3=CC=C(C=C3)C(=O)Cl)C4=CC=CC=C4.Cl

Computed by PubChem (NCBI)