CAS 2705226-73-7 appears in our catalog under these names: N–hexanoyl–L–Homoserine lactone–d3, N-Hexanoyl-L-Homoserine lactone-d3, 98.2%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 10mg, 5mg, 500μg, 5 mg, 10 mg, 1 mg.
6,6,6-trideuterio-N-[(3S)-2-oxooxolan-3-yl]hexanamide (CAS 2705226-73-7) is a chemical compound with the molecular formula C10H17NO3 and a molecular weight of 202.27 g/mol. IUPAC name: 6,6,6-trideuterio-N-[(3S)-2-oxooxolan-3-yl]hexanamide. InChIKey: ZJFKKPDLNLCPNP-TUWYYBGVSA-N.
| Molecular formula | C10H17NO3 |
|---|---|
| Molecular weight | 202.27 g/mol |
| IUPAC name | 6,6,6-trideuterio-N-[(3S)-2-oxooxolan-3-yl]hexanamide |
| InChIKey | ZJFKKPDLNLCPNP-TUWYYBGVSA-N |
| SMILES | [2H]C([2H])([2H])CCCCC(=O)N[C@H]1CCOC1=O |
Computed by PubChem (NCBI)