CAS 270564-31-3 is the registry number for Fipronil Impurity 1. Offered by: Chemat Brand. Available pack sizes: on request.
N-[5-amino-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]pyrazol-3-yl]formamide (CAS 270564-31-3) is a chemical compound with the molecular formula C11H7Cl2F3N4O and a molecular weight of 339.10 g/mol. IUPAC name: N-[5-amino-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]pyrazol-3-yl]formamide. InChIKey: QZUOZQHKHYZRTN-UHFFFAOYSA-N.
| Molecular formula | C11H7Cl2F3N4O |
|---|---|
| Molecular weight | 339.10 g/mol |
| IUPAC name | N-[5-amino-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]pyrazol-3-yl]formamide |
| InChIKey | QZUOZQHKHYZRTN-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Cl)N2C(=CC(=N2)NC=O)N)Cl)C(F)(F)F |
Computed by PubChem (NCBI)