CAS 270564-49-3 appears in our catalog under these names: Sodium Butyrate-d7, 98 atom % D, min 98% Chemical Purity, Sodium Butyrate-d7, >95% (HPLC). Offered by: CDN, TRC. Available pack sizes: 1g, 0,5g, 100mg, 10mg, 50mg.
Sodium 2,2,3,3,4,4,4-heptadeuteriobutanoate (CAS 270564-49-3) is a chemical compound with the molecular formula C4H7NaO2 and a molecular weight of 117.13 g/mol. IUPAC name: sodium 2,2,3,3,4,4,4-heptadeuteriobutanoate. InChIKey: MFBOGIVSZKQAPD-DEPOAORMSA-M.
| Molecular formula | C4H7NaO2 |
|---|---|
| Molecular weight | 117.13 g/mol |
| IUPAC name | sodium 2,2,3,3,4,4,4-heptadeuteriobutanoate |
| InChIKey | MFBOGIVSZKQAPD-DEPOAORMSA-M |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C(=O)[O-].[Na+] |
Computed by PubChem (NCBI)