CAS 27058-83-9 appears in our catalog under these names: 2-Amino-4-chlorobenzothiazole hydrobromide, 95%, 4-Chlorobenzo(d)thiazol-2-amine hydrobromide, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
4-chloro-1,3-benzothiazol-2-amine;hydrobromide (CAS 27058-83-9) is a chemical compound with the molecular formula C7H6BrClN2S and a molecular weight of 265.56 g/mol. IUPAC name: 4-chloro-1,3-benzothiazol-2-amine;hydrobromide. InChIKey: DXXACNSRSDYMOR-UHFFFAOYSA-N.
| Molecular formula | C7H6BrClN2S |
|---|---|
| Molecular weight | 265.56 g/mol |
| IUPAC name | 4-chloro-1,3-benzothiazol-2-amine;hydrobromide |
| InChIKey | DXXACNSRSDYMOR-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Cl)N=C(S2)N.Br |
Computed by PubChem (NCBI)