CAS 270586-78-2 is the registry number for (Di-p-tolylphosphoryl)(mesityl)methanone, 98%, 98%. Offered by: Chemat. Available pack sizes: 25g, 100g, 500g.
Bis(4-methylphenyl)phosphoryl-(2,4,6-trimethylphenyl)methanone (CAS 270586-78-2) is a chemical compound with the molecular formula C24H25O2P and a molecular weight of 376.4 g/mol. IUPAC name: bis(4-methylphenyl)phosphoryl-(2,4,6-trimethylphenyl)methanone. InChIKey: DZHSVSBJDNJICY-UHFFFAOYSA-N.
| Molecular formula | C24H25O2P |
|---|---|
| Molecular weight | 376.4 g/mol |
| IUPAC name | bis(4-methylphenyl)phosphoryl-(2,4,6-trimethylphenyl)methanone |
| InChIKey | DZHSVSBJDNJICY-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)P(=O)(C2=CC=C(C=C2)C)C(=O)C3=C(C=C(C=C3C)C)C |
Computed by PubChem (NCBI)