CAS 2706-89-0 appears in our catalog under these names: sodium nonafluoropentanoate, 95%, Sodium nonafluoropentanoate, 97%, Sodium nonafluoropentanoate. Offered by: Combi-blocks, Chemat Brand, Fluorochem. Available pack sizes: 5g, 1g, on request.
Sodium 2,2,3,3,4,4,5,5,5-nonafluoropentanoate (CAS 2706-89-0) is a chemical compound with the molecular formula C5F9NaO2 and a molecular weight of 286.03 g/mol. IUPAC name: sodium 2,2,3,3,4,4,5,5,5-nonafluoropentanoate. InChIKey: UOOGXJXDGDKHDT-UHFFFAOYSA-M.
| Molecular formula | C5F9NaO2 |
|---|---|
| Molecular weight | 286.03 g/mol |
| IUPAC name | sodium 2,2,3,3,4,4,5,5,5-nonafluoropentanoate |
| InChIKey | UOOGXJXDGDKHDT-UHFFFAOYSA-M |
| SMILES | C(=O)(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)[O-].[Na+] |
Computed by PubChem (NCBI)