Products 2706202-50-6
CAS 2706202-50-6 is the registry number for 2,3-Dichloro-1-(methylthio)-4-(trifluoromethyl)benzene, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2,3-dichloro-1-methylsulfanyl-4-(trifluoromethyl)benzene (CAS 2706202-50-6) is a chemical compound with the molecular formula C8H5Cl2F3S and a molecular weight of 261.09 g/mol. IUPAC name: 2,3-dichloro-1-methylsulfanyl-4-(trifluoromethyl)benzene. InChIKey: VKXKGUQLNVVYPH-UHFFFAOYSA-N.
| Molecular formula | C8H5Cl2F3S |
|---|---|
| Molecular weight | 261.09 g/mol |
| IUPAC name | 2,3-dichloro-1-methylsulfanyl-4-(trifluoromethyl)benzene |
| InChIKey | VKXKGUQLNVVYPH-UHFFFAOYSA-N |
| SMILES | CSC1=C(C(=C(C=C1)C(F)(F)F)Cl)Cl |
Computed by PubChem (NCBI)