Products 2706488-76-6
CAS 2706488-76-6 is the registry number for N3-Gly-Gly-OH (DCHA). Offered by: MedChemExpress. Available pack sizes: Get quote.
2-[(2-azidoacetyl)amino]acetic acid;N-cyclohexylcyclohexanamine (CAS 2706488-76-6) is a chemical compound with the molecular formula C16H29N5O3 and a molecular weight of 339.43 g/mol. IUPAC name: 2-[(2-azidoacetyl)amino]acetic acid;N-cyclohexylcyclohexanamine. InChIKey: URKIOVJESPPVFO-UHFFFAOYSA-N.
| Molecular formula | C16H29N5O3 |
|---|---|
| Molecular weight | 339.43 g/mol |
| IUPAC name | 2-[(2-azidoacetyl)amino]acetic acid;N-cyclohexylcyclohexanamine |
| InChIKey | URKIOVJESPPVFO-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)NC2CCCCC2.C(C(=O)O)NC(=O)CN=[N+]=[N-] |
Computed by PubChem (NCBI)