Products 2707473-09-2

CAS 2707473-09-2 is the registry number for LTA4H-IN-3. Offered by: MedChemExpress. Available pack sizes: Get quote.

Structural formula: {0} (CAS {1})

4-[5-[4-(4-chlorophenoxy)phenyl]tetrazol-2-yl]butanoic acid (CAS 2707473-09-2) is a chemical compound with the molecular formula C17H15ClN4O3 and a molecular weight of 358.8 g/mol. IUPAC name: 4-[5-[4-(4-chlorophenoxy)phenyl]tetrazol-2-yl]butanoic acid. InChIKey: AQANURZKWAQXDO-UHFFFAOYSA-N.

Identity
Molecular formulaC17H15ClN4O3
Molecular weight358.8 g/mol
IUPAC name4-[5-[4-(4-chlorophenoxy)phenyl]tetrazol-2-yl]butanoic acid
InChIKeyAQANURZKWAQXDO-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1C2=NN(N=N2)CCCC(=O)O)OC3=CC=C(C=C3)Cl

Computed by PubChem (NCBI)

Synonyms: orb2565856