Products 2708278-02-6
CAS 2708278-02-6 appears in our catalog under these names: (�-Bromopropionic-3,3,3-d3 Acid, (±)-2-Bromopropionic-3,3,3-d3 Acid, 98 atom % D, min 98% Chemical Purity. Offered by: TRC, CDN. Available pack sizes: 250mg, 1g, 0,5g.
2-bromo-3,3,3-trideuteriopropanoic acid (CAS 2708278-02-6) is a chemical compound with the molecular formula C3H5BrO2 and a molecular weight of 155.99 g/mol. IUPAC name: 2-bromo-3,3,3-trideuteriopropanoic acid. InChIKey: MONMFXREYOKQTI-FIBGUPNXSA-N.
| Molecular formula | C3H5BrO2 |
|---|---|
| Molecular weight | 155.99 g/mol |
| IUPAC name | 2-bromo-3,3,3-trideuteriopropanoic acid |
| InChIKey | MONMFXREYOKQTI-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])C(C(=O)O)Br |
Computed by PubChem (NCBI)
Synonyms:
(?-Bromopropionic-3,3,3-d3 Acid