Products 2708278-87-7
CAS 2708278-87-7 appears in our catalog under these names: Rotigotine N-Oxide, Rotigotine EP Impurity E (Rotigotine N-Oxide). Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-5-hydroxy-N-propyl-N-(2-thiophen-2-ylethyl)-1,2,3,4-tetrahydronaphthalen-2-amine oxide (CAS 2708278-87-7) is a chemical compound with the molecular formula C19H25NO2S and a molecular weight of 331.5 g/mol. IUPAC name: (2S)-5-hydroxy-N-propyl-N-(2-thiophen-2-ylethyl)-1,2,3,4-tetrahydronaphthalen-2-amine oxide. InChIKey: WEBNUJHMZUJCTN-DJZRFWRSSA-N.
| Molecular formula | C19H25NO2S |
|---|---|
| Molecular weight | 331.5 g/mol |
| IUPAC name | (2S)-5-hydroxy-N-propyl-N-(2-thiophen-2-ylethyl)-1,2,3,4-tetrahydronaphthalen-2-amine oxide |
| InChIKey | WEBNUJHMZUJCTN-DJZRFWRSSA-N |
| SMILES | CCC[N+](CCC1=CC=CS1)([C@H]2CCC3=C(C2)C=CC=C3O)[O-] |
Computed by PubChem (NCBI)