Products 2708280-12-8
CAS 2708280-12-8 appears in our catalog under these names: n-Heptyl 4-hydroxybenzoate-d4, >95% (HPLC), n-Heptyl 4-Hydroxybenzoate-2,3,5,6-d4, 98 atom % D, min 98% Chemical Purity, N-Heptyl 4-hydroxybenzoate-d4. Offered by: TRC, CDN, MedChemExpress. Available pack sizes: 10mg, 2,5mg, 25mg, 0,1g, 0,05g, 25 mg, 50 mg, 5 mg.
Heptyl 2,3,5,6-tetradeuterio-4-hydroxybenzoate (CAS 2708280-12-8) is a chemical compound with the molecular formula C14H20O3 and a molecular weight of 240.33 g/mol. IUPAC name: heptyl 2,3,5,6-tetradeuterio-4-hydroxybenzoate. InChIKey: ZTJORNVITHUQJA-ULDPCNCHSA-N.
| Molecular formula | C14H20O3 |
|---|---|
| Molecular weight | 240.33 g/mol |
| IUPAC name | heptyl 2,3,5,6-tetradeuterio-4-hydroxybenzoate |
| InChIKey | ZTJORNVITHUQJA-ULDPCNCHSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1C(=O)OCCCCCCC)[2H])[2H])O)[2H] |
Computed by PubChem (NCBI)