Products 2708283-13-8
CAS 2708283-13-8 appears in our catalog under these names: 5-Methyl-3-heptyl Alcohol-d18 (mixture of stereoisomers), 98 atom % D, min 98% Chemical Purity, 5-Methylheptan-3-ol-d18. Offered by: CDN, MedChemExpress. Available pack sizes: 0,25g, 0,1g, 1 mg.
1,1,1,2,2,3,4,4,5,6,6,7,7,7-tetradecadeuterio-3-deuteriooxy-5-(trideuteriomethyl)heptane (CAS 2708283-13-8) is a chemical compound with the molecular formula C8H18O and a molecular weight of 148.34 g/mol. IUPAC name: 1,1,1,2,2,3,4,4,5,6,6,7,7,7-tetradecadeuterio-3-deuteriooxy-5-(trideuteriomethyl)heptane. InChIKey: SECKOSOTZOBWEI-WMQNGQRQSA-N.
| Molecular formula | C8H18O |
|---|---|
| Molecular weight | 148.34 g/mol |
| IUPAC name | 1,1,1,2,2,3,4,4,5,6,6,7,7,7-tetradecadeuterio-3-deuteriooxy-5-(trideuteriomethyl)heptane |
| InChIKey | SECKOSOTZOBWEI-WMQNGQRQSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])(C([2H])([2H])[2H])C([2H])([2H])C([2H])(C([2H])([2H])C([2H])([2H])[2H])O[2H] |
Computed by PubChem (NCBI)