Products 2708286-78-4
CAS 2708286-78-4 appears in our catalog under these names: Ethyl (±)-2-Methylbutyrate-d9, 99 atom % D, min 98% Chemical Purity, Ethyl 2-methylbutanoate-d9. Offered by: CDN, MedChemExpress. Available pack sizes: 0,5g, 0,25g, 1 mg.
Ethyl 2,3,3,4,4,4-hexadeuterio-2-(trideuteriomethyl)butanoate (CAS 2708286-78-4) is a chemical compound with the molecular formula C7H14O2 and a molecular weight of 139.24 g/mol. IUPAC name: ethyl 2,3,3,4,4,4-hexadeuterio-2-(trideuteriomethyl)butanoate. InChIKey: HCRBXQFHJMCTLF-ZMECLBIQSA-N.
| Molecular formula | C7H14O2 |
|---|---|
| Molecular weight | 139.24 g/mol |
| IUPAC name | ethyl 2,3,3,4,4,4-hexadeuterio-2-(trideuteriomethyl)butanoate |
| InChIKey | HCRBXQFHJMCTLF-ZMECLBIQSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])(C(=O)OCC)C([2H])([2H])[2H] |
Computed by PubChem (NCBI)