CAS 2708286-89-7 appears in our catalog under these names: Cyclohexanecarbonyl-d11 Chloride, 98 atom % D, min 98% Chemical Purity, (Chlorocarbonyl)cyclohexane-d11. Offered by: CDN, MedChemExpress. Available pack sizes: 0,5g, 0,25g, 1 mg.
1,2,2,3,3,4,4,5,5,6,6-undecadeuteriocyclohexane-1-carbonyl chloride (CAS 2708286-89-7) is a chemical compound with the molecular formula C7H11ClO and a molecular weight of 157.68 g/mol. IUPAC name: 1,2,2,3,3,4,4,5,5,6,6-undecadeuteriocyclohexane-1-carbonyl chloride. InChIKey: RVOJTCZRIKWHDX-KAFHOZLVSA-N.
| Molecular formula | C7H11ClO |
|---|---|
| Molecular weight | 157.68 g/mol |
| IUPAC name | 1,2,2,3,3,4,4,5,5,6,6-undecadeuteriocyclohexane-1-carbonyl chloride |
| InChIKey | RVOJTCZRIKWHDX-KAFHOZLVSA-N |
| SMILES | [2H]C1(C(C(C(C(C1([2H])[2H])([2H])[2H])([2H])C(=O)Cl)([2H])[2H])([2H])[2H])[2H] |
Computed by PubChem (NCBI)