Products 2708287-37-8
CAS 2708287-37-8 appears in our catalog under these names: 2-Amino-1,3-propanediol-1,1,2,3,3-d5, 98 atom % D, min 98% Chemical Purity, Serinol-d5. Offered by: CDN, MedChemExpress. Available pack sizes: 0,1g, 0,05g, 1 mg.
2-amino-1,1,2,3,3-pentadeuteriopropane-1,3-diol (CAS 2708287-37-8) is a chemical compound with the molecular formula C3H9NO2 and a molecular weight of 96.14 g/mol. IUPAC name: 2-amino-1,1,2,3,3-pentadeuteriopropane-1,3-diol. InChIKey: KJJPLEZQSCZCKE-UXXIZXEISA-N.
| Molecular formula | C3H9NO2 |
|---|---|
| Molecular weight | 96.14 g/mol |
| IUPAC name | 2-amino-1,1,2,3,3-pentadeuteriopropane-1,3-diol |
| InChIKey | KJJPLEZQSCZCKE-UXXIZXEISA-N |
| SMILES | [2H]C([2H])(C([2H])(C([2H])([2H])O)N)O |
Computed by PubChem (NCBI)