Products 2708298-33-1
CAS 2708298-33-1 appears in our catalog under these names: p–Coumaric acid–d6, trans-p-Coumaric-d6 Acid, >95% (HPLC), p-Coumaric acid-d6, ≥98%,≥98 atom% D, ≥98%,≥98 atom% D, p-Coumaric acid-d6, 98.88%. Offered by: GLPBio, TRC, Chemat, MedChemExpress. Available pack sizes: 1mg, 100mg, 25mg, 5mg, 10mg, 5 mg, 10 mg.
(E)-2,3-dideuterio-3-(2,3,5,6-tetradeuterio-4-hydroxyphenyl)prop-2-enoic acid (CAS 2708298-33-1) is a chemical compound with the molecular formula C9H8O3 and a molecular weight of 170.19 g/mol. IUPAC name: (E)-2,3-dideuterio-3-(2,3,5,6-tetradeuterio-4-hydroxyphenyl)prop-2-enoic acid. InChIKey: NGSWKAQJJWESNS-IMQXGSLKSA-N.
| Molecular formula | C9H8O3 |
|---|---|
| Molecular weight | 170.19 g/mol |
| IUPAC name | (E)-2,3-dideuterio-3-(2,3,5,6-tetradeuterio-4-hydroxyphenyl)prop-2-enoic acid |
| InChIKey | NGSWKAQJJWESNS-IMQXGSLKSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1/C(=C(\[2H])/C(=O)O)/[2H])[2H])[2H])O)[2H] |
Computed by PubChem (NCBI)